cas: 2138894-45-6 — see every product listed under this CAS number, including other names
(2-Bromo-4,5-dimethylphenyl)boronic acid, 98% (CAS 2138894-45-6) is a chemical reagent available from Chemat. Available pack sizes: 25g, 5g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1632655-25g |
| cas | 2138894-45-6 |
| size | 25g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 19873.42 Pln | |
| AmBeed | 5g | 5994.10 Pln | |
| AmBeed | 10g | 10140.97 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
(2-bromo-4,5-dimethylphenyl)boronic acid (CAS 2138894-45-6) is a chemical compound with the molecular formula C8H10BBrO2 and a molecular weight of 228.88 g/mol. IUPAC name: (2-bromo-4,5-dimethylphenyl)boronic acid. InChIKey: GQIKWHOKUNTVBM-UHFFFAOYSA-N.
| Molecular formula | C8H10BBrO2 |
|---|---|
| Molecular weight | 228.88 g/mol |
| IUPAC name | (2-bromo-4,5-dimethylphenyl)boronic acid |
| InChIKey | GQIKWHOKUNTVBM-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1Br)C)C)(O)O |
Computed by PubChem (NCBI)