CAS 81574-69-8 appears in our catalog under these names: 2–Bromo–4,6–dimethoxybenzaldehyde, 2-Bromo-4,6-dimethoxybenzaldehyde, 2-Bromo-4,6-dimethoxybenzaldehyde, 98%, 98%, 2-BROMO-4,6-DIMETHOXYBENZALDEHYDE, 97%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 2,5g, 100mg, 250mg.
2-bromo-4,6-dimethoxybenzaldehyde (CAS 81574-69-8) is a chemical compound with the molecular formula C9H9BrO3 and a molecular weight of 245.07 g/mol. IUPAC name: 2-bromo-4,6-dimethoxybenzaldehyde. InChIKey: PEKSAHQVDKQWST-UHFFFAOYSA-N.
| Molecular formula | C9H9BrO3 |
|---|---|
| Molecular weight | 245.07 g/mol |
| IUPAC name | 2-bromo-4,6-dimethoxybenzaldehyde |
| InChIKey | PEKSAHQVDKQWST-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1)Br)C=O)OC |
Computed by PubChem (NCBI)