Products 61809-40-3
CAS 61809-40-3 appears in our catalog under these names: 2-Bromo-5-methoxy-4-methylbenzoic acid, 98%, 2-Bromo-5-methoxy-4-methylbenzoic acid, 2-Bromo-5-methoxy-4-methylbenzoic acid 95%, 2-Bromo-5-methoxy-4-methylbenzoic acid, 95%, 95%, 2-BROMO-5-METHOXY-4-METHYLBENZOIC ACID, 95%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 10g, 250mg, 100mg.
2-bromo-5-methoxy-4-methylbenzoic acid (CAS 61809-40-3) is a chemical compound with the molecular formula C9H9BrO3 and a molecular weight of 245.07 g/mol. IUPAC name: 2-bromo-5-methoxy-4-methylbenzoic acid. InChIKey: BFPGCWOVXJFKPY-UHFFFAOYSA-N.
| Molecular formula | C9H9BrO3 |
|---|---|
| Molecular weight | 245.07 g/mol |
| IUPAC name | 2-bromo-5-methoxy-4-methylbenzoic acid |
| InChIKey | BFPGCWOVXJFKPY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1OC)C(=O)O)Br |
Computed by PubChem (NCBI)