CAS 6948-30-7 appears in our catalog under these names: 3-Bromo-4,5-dimethoxybenzaldehyde, 98%, 3-Bromo-4,5-dimethoxybenzaldehyde, 95+%, 3-Bromo-4,5-dimethoxybenzaldehyde, 3-Bromo-4,5-dimethoxybenzaldehyde, >98.0%(GC), 3-Bromo-4,5-dimethoxybenzaldehyde 95%. Offered by: Combi-blocks, AmBeed, Biosynth, TCI, Sigma-Aldrich. Available pack sizes: 1g, 25g, 5g, 250mg, 10g, 50g, 100g.
3-bromo-4,5-dimethoxybenzaldehyde (CAS 6948-30-7) is a chemical compound with the molecular formula C9H9BrO3 and a molecular weight of 245.07 g/mol. IUPAC name: 3-bromo-4,5-dimethoxybenzaldehyde. InChIKey: ICVODPFGWCUVJC-UHFFFAOYSA-N.
| Molecular formula | C9H9BrO3 |
|---|---|
| Molecular weight | 245.07 g/mol |
| IUPAC name | 3-bromo-4,5-dimethoxybenzaldehyde |
| InChIKey | ICVODPFGWCUVJC-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC(=C1)C=O)Br)OC |
Computed by PubChem (NCBI)