CAS 1260889-94-8 appears in our catalog under these names: Ethyl 2-bromo-3-hydroxybenzoate, 95%, 2-Bromo-3-hydroxybenzoic acid ethyl ester. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 10g, 1g, 1000mg, 500mg, 2000mg, 5000mg.
Ethyl 2-bromo-3-hydroxybenzoate (CAS 1260889-94-8) is a chemical compound with the molecular formula C9H9BrO3 and a molecular weight of 245.07 g/mol. IUPAC name: ethyl 2-bromo-3-hydroxybenzoate. InChIKey: OSCVFQZMFHWWCM-UHFFFAOYSA-N.
| Molecular formula | C9H9BrO3 |
|---|---|
| Molecular weight | 245.07 g/mol |
| IUPAC name | ethyl 2-bromo-3-hydroxybenzoate |
| InChIKey | OSCVFQZMFHWWCM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C(=CC=C1)O)Br |
Computed by PubChem (NCBI)