Products 853908-26-6
CAS 853908-26-6 appears in our catalog under these names: (2S)-3-(4-Bromophenyl)-2-hydroxypropanoic acid, 95%, (S)-3-(4-Bromophenyl)-2-hydroxypropionic Acid, ≥95%, ≥95%, (S)-3-(4-Bromophenyl)-2-hydroxypropanoic acid, ≥95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 10g, 5g, 100mg.
(2S)-3-(4-bromophenyl)-2-hydroxypropanoic acid (CAS 853908-26-6) is a chemical compound with the molecular formula C9H9BrO3 and a molecular weight of 245.07 g/mol. IUPAC name: (2S)-3-(4-bromophenyl)-2-hydroxypropanoic acid. InChIKey: YVPYVGILADXNJV-QMMMGPOBSA-N.
| Molecular formula | C9H9BrO3 |
|---|---|
| Molecular weight | 245.07 g/mol |
| IUPAC name | (2S)-3-(4-bromophenyl)-2-hydroxypropanoic acid |
| InChIKey | YVPYVGILADXNJV-QMMMGPOBSA-N |
| SMILES | C1=CC(=CC=C1C[C@@H](C(=O)O)O)Br |
Computed by PubChem (NCBI)