2-Bromo-4-chloro-3-fluorobenzaldehyde, 95%
cas: 1785320-57-1 — see every product listed under this CAS number, including other names
2-Bromo-4-chloro-3-fluorobenzaldehyde, 95% (CAS 1785320-57-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A817892-100mg |
| cas | 1785320-57-1 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 476.06 Pln | |
| Ambeed | 250mg | 787.56 Pln | |
| Ambeed | 1g | 1927.88 Pln | |
| Ambeed | 5g | 6350.06 Pln | |
| BLDpharm | 100mg | 508.73 Pln | |
| BLDpharm | 250mg | 847.50 Pln | |
| BLDpharm | 1g | 2074.85 Pln | |
| BLDpharm | 5g | 6845.39 Pln | |
| Chemat | 100mg | 338.00 Pln | |
| Chemat | 250mg | 554.00 Pln | |
| Chemat | 1g | 1341.20 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
2-bromo-4-chloro-3-fluorobenzaldehyde (CAS 1785320-57-1) is a chemical compound with the molecular formula C7H3BrClFO and a molecular weight of 237.45 g/mol. IUPAC name: 2-bromo-4-chloro-3-fluorobenzaldehyde. InChIKey: UVCFHCYNDGSSIA-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClFO |
|---|---|
| Molecular weight | 237.45 g/mol |
| IUPAC name | 2-bromo-4-chloro-3-fluorobenzaldehyde |
| InChIKey | UVCFHCYNDGSSIA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C=O)Br)F)Cl |
Computed by PubChem (NCBI)
