cas: 351003-21-9 — see every product listed under this CAS number, including other names
2-Bromo-4-fluorobenzotrifluoride 98% (CAS 351003-21-9) is a chemical reagent available from Chemat. Available pack sizes: 1000g, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A267091-1000g |
| cas | 351003-21-9 |
| size | 1000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1000g | 5432.25 Pln | |
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 136.75 Pln | |
| Ambeed | 10g | 153.44 Pln | |
| Ambeed | 25g | 253.56 Pln | |
| Ambeed | 100g | 670.75 Pln | |
| Ambeed | 500g | 3029.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A267091 |
2-bromo-4-fluoro-1-(trifluoromethyl)benzene (CAS 351003-21-9) is a chemical compound with the molecular formula C7H3BrF4 and a molecular weight of 243.00 g/mol. IUPAC name: 2-bromo-4-fluoro-1-(trifluoromethyl)benzene. InChIKey: XBBGYSIEJHXPLL-UHFFFAOYSA-N.
| Molecular formula | C7H3BrF4 |
|---|---|
| Molecular weight | 243.00 g/mol |
| IUPAC name | 2-bromo-4-fluoro-1-(trifluoromethyl)benzene |
| InChIKey | XBBGYSIEJHXPLL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)Br)C(F)(F)F |
Computed by PubChem (NCBI)