Products 1628442-65-8
CAS 1628442-65-8 appears in our catalog under these names: 1-Bromo-4-(difluoromethyl)-2,5-difluorobenzene, 95%, 1-Bromo-4-(difluoromethyl)-2,5-difluorobenzene. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 2,5g.
1-bromo-4-(difluoromethyl)-2,5-difluorobenzene (CAS 1628442-65-8) is a chemical compound with the molecular formula C7H3BrF4 and a molecular weight of 243.00 g/mol. IUPAC name: 1-bromo-4-(difluoromethyl)-2,5-difluorobenzene. InChIKey: XTGNEVHXMFTHIC-UHFFFAOYSA-N.
| Molecular formula | C7H3BrF4 |
|---|---|
| Molecular weight | 243.00 g/mol |
| IUPAC name | 1-bromo-4-(difluoromethyl)-2,5-difluorobenzene |
| InChIKey | XTGNEVHXMFTHIC-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)Br)F)C(F)F |
Computed by PubChem (NCBI)