CAS 1804408-83-0 appears in our catalog under these names: 2-bromo-4-(difluoromethyl)-1,3-difluorobenzene, 95%, 3-Bromo-2,4-difluorobenzal fluoride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 250mg, 100mg.
3-bromo-1-(difluoromethyl)-2,4-difluorobenzene (CAS 1804408-83-0) is a chemical compound with the molecular formula C7H3BrF4 and a molecular weight of 243.00 g/mol. IUPAC name: 3-bromo-1-(difluoromethyl)-2,4-difluorobenzene. InChIKey: NZCUEIOQCHMPGI-UHFFFAOYSA-N.
| Molecular formula | C7H3BrF4 |
|---|---|
| Molecular weight | 243.00 g/mol |
| IUPAC name | 3-bromo-1-(difluoromethyl)-2,4-difluorobenzene |
| InChIKey | NZCUEIOQCHMPGI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(F)F)F)Br)F |
Computed by PubChem (NCBI)