Products 53001-73-3
CAS 53001-73-3 appears in our catalog under these names: 2,3,5,6-Tetrafluorobenzylbromide 98%, 2,3,5,6-Tetrafluorobenzylbromide, 98%, 98%, 2,3,5,6-Tetrafluorobenzyl bromide, 97%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 25g.
3-(bromomethyl)-1,2,4,5-tetrafluorobenzene (CAS 53001-73-3) is a chemical compound with the molecular formula C7H3BrF4 and a molecular weight of 243.00 g/mol. IUPAC name: 3-(bromomethyl)-1,2,4,5-tetrafluorobenzene. InChIKey: QHZBSXQCGIQSID-UHFFFAOYSA-N.
| Molecular formula | C7H3BrF4 |
|---|---|
| Molecular weight | 243.00 g/mol |
| IUPAC name | 3-(bromomethyl)-1,2,4,5-tetrafluorobenzene |
| InChIKey | QHZBSXQCGIQSID-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1F)F)CBr)F)F |
Computed by PubChem (NCBI)