Products 1221272-77-0
CAS 1221272-77-0 appears in our catalog under these names: 5-Bromo-2-(difluoromethyl)-1,3-difluorobenzene, 5-Bromo-2-(difluoromethyl)-1,3-difluorobenzene 95%, 5-Bromo-2-(Difluoromethyl)-1,3-Difluorobenzene, 95%, 95%, 5-Bromo-2-(difluoromethyl)-1,3-difluorobenzene, 95%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 2,5g, 100mg, 250mg, 1g, 5g, 10g, 25g.
5-bromo-2-(difluoromethyl)-1,3-difluorobenzene (CAS 1221272-77-0) is a chemical compound with the molecular formula C7H3BrF4 and a molecular weight of 243.00 g/mol. IUPAC name: 5-bromo-2-(difluoromethyl)-1,3-difluorobenzene. InChIKey: KAXWWASZWQHCBC-UHFFFAOYSA-N.
| Molecular formula | C7H3BrF4 |
|---|---|
| Molecular weight | 243.00 g/mol |
| IUPAC name | 5-bromo-2-(difluoromethyl)-1,3-difluorobenzene |
| InChIKey | KAXWWASZWQHCBC-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)C(F)F)F)Br |
Computed by PubChem (NCBI)