2-Bromo-5-(trifluoromethyl)phenol, 95%
cas: 402-05-1 — see every product listed under this CAS number, including other names
2-Bromo-5-(trifluoromethyl)phenol, 95% (CAS 402-05-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A198780-1g |
| cas | 402-05-1 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 125.62 Pln | |
| Ambeed | 5g | 170.12 Pln | |
| Ambeed | 10g | 231.31 Pln | |
| Ambeed | 25g | 448.25 Pln | |
| Ambeed | 100g | 1277.06 Pln | |
| Ambeed | 500g | 6094.19 Pln | |
| BLDpharm | 1g | 125.54 Pln | |
| BLDpharm | 5g | 181.07 Pln | |
| BLDpharm | 10g | 242.16 Pln | |
| BLDpharm | 25g | 475.41 Pln | |
| BLDpharm | 100g | 1369.54 Pln | |
| BLDpharm | 500g | 6562.16 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
2-bromo-5-(trifluoromethyl)phenol (CAS 402-05-1) is a chemical compound with the molecular formula C7H4BrF3O and a molecular weight of 241.00 g/mol. IUPAC name: 2-bromo-5-(trifluoromethyl)phenol. InChIKey: INHVNZLKNPJCJD-UHFFFAOYSA-N.
| Molecular formula | C7H4BrF3O |
|---|---|
| Molecular weight | 241.00 g/mol |
| IUPAC name | 2-bromo-5-(trifluoromethyl)phenol |
| InChIKey | INHVNZLKNPJCJD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)O)Br |
Computed by PubChem (NCBI)