CAS 1242249-28-0 appears in our catalog under these names: 1-Bromo-3-(difluoromethoxy)-2-fluorobenzene, 95%, 1-Bromo-3-(difluoromethoxy)-2-fluorobenzene. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 50mg, 0,5g.
1-bromo-3-(difluoromethoxy)-2-fluorobenzene (CAS 1242249-28-0) is a chemical compound with the molecular formula C7H4BrF3O and a molecular weight of 241.00 g/mol. IUPAC name: 1-bromo-3-(difluoromethoxy)-2-fluorobenzene. InChIKey: NHFNQTPCXZRLFQ-UHFFFAOYSA-N.
| Molecular formula | C7H4BrF3O |
|---|---|
| Molecular weight | 241.00 g/mol |
| IUPAC name | 1-bromo-3-(difluoromethoxy)-2-fluorobenzene |
| InChIKey | NHFNQTPCXZRLFQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)F)OC(F)F |
Computed by PubChem (NCBI)