CAS 1260825-79-3 is the registry number for (3-Bromo-2,4,5-trifluorophenyl)methanol, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
(3-bromo-2,4,5-trifluorophenyl)methanol (CAS 1260825-79-3) is a chemical compound with the molecular formula C7H4BrF3O and a molecular weight of 241.00 g/mol. IUPAC name: (3-bromo-2,4,5-trifluorophenyl)methanol. InChIKey: IJJUTVTUBSSHKT-UHFFFAOYSA-N.
| Molecular formula | C7H4BrF3O |
|---|---|
| Molecular weight | 241.00 g/mol |
| IUPAC name | (3-bromo-2,4,5-trifluorophenyl)methanol |
| InChIKey | IJJUTVTUBSSHKT-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1F)F)Br)F)CO |
Computed by PubChem (NCBI)