Products 954235-98-4
CAS 954235-98-4 appears in our catalog under these names: 1-Bromo-2-difluoromethoxy-3-fluoro-benzene, 95%, 1-bromo-2-(difluoromethoxy)-3-fluorobenzene. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 5g.
1-bromo-2-(difluoromethoxy)-3-fluorobenzene (CAS 954235-98-4) is a chemical compound with the molecular formula C7H4BrF3O and a molecular weight of 241.00 g/mol. IUPAC name: 1-bromo-2-(difluoromethoxy)-3-fluorobenzene. InChIKey: KUCGCFDIABRYPJ-UHFFFAOYSA-N.
| Molecular formula | C7H4BrF3O |
|---|---|
| Molecular weight | 241.00 g/mol |
| IUPAC name | 1-bromo-2-(difluoromethoxy)-3-fluorobenzene |
| InChIKey | KUCGCFDIABRYPJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)OC(F)F)F |
Computed by PubChem (NCBI)