CAS 511511-02-7 appears in our catalog under these names: (5-Bromo-2,3,4-trifluorophenyl)methanol, 95%, 5-Bromo-2,3,4-trifluorobenzyl alcohol, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 25g, 5g, 1g, 250mg.
(5-bromo-2,3,4-trifluorophenyl)methanol (CAS 511511-02-7) is a chemical compound with the molecular formula C7H4BrF3O and a molecular weight of 241.00 g/mol. IUPAC name: (5-bromo-2,3,4-trifluorophenyl)methanol. InChIKey: PRMLCVWLYPTWAH-UHFFFAOYSA-N.
| Molecular formula | C7H4BrF3O |
|---|---|
| Molecular weight | 241.00 g/mol |
| IUPAC name | (5-bromo-2,3,4-trifluorophenyl)methanol |
| InChIKey | PRMLCVWLYPTWAH-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Br)F)F)F)CO |
Computed by PubChem (NCBI)