cas: 65550-79-0 — see every product listed under this CAS number, including other names
2-Bromo-5-chloronicotinic acid 95% (CAS 65550-79-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A242520-250mg |
| cas | 65550-79-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 231.31 Pln | |
| Ambeed | 1g | 309.19 Pln | |
| Ambeed | 5g | 904.38 Pln | |
| Ambeed | 10g | 1460.62 Pln | |
| Ambeed | 25g | 2851.25 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A242520 |
2-bromo-5-chloropyridine-3-carboxylic acid (CAS 65550-79-0) is a chemical compound with the molecular formula C6H3BrClNO2 and a molecular weight of 236.45 g/mol. IUPAC name: 2-bromo-5-chloropyridine-3-carboxylic acid. InChIKey: KVUYLDGVNHUHCA-UHFFFAOYSA-N.
| Molecular formula | C6H3BrClNO2 |
|---|---|
| Molecular weight | 236.45 g/mol |
| IUPAC name | 2-bromo-5-chloropyridine-3-carboxylic acid |
| InChIKey | KVUYLDGVNHUHCA-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1C(=O)O)Br)Cl |
Computed by PubChem (NCBI)