cas: 81682-38-4 — see every product listed under this CAS number, including other names
2-Bromo-5-chlorophenylacetic acid, 98% (CAS 81682-38-4) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F110700-10G |
| cas | 81682-38-4 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 10g | 133.30 Pln | |
| Fluorochem | 25g | 247.85 Pln | |
| Fluorochem | 100g | 810.15 Pln | |
| Fluorochem | 500g | 3819.51 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
2-(2-bromo-5-chlorophenyl)acetic acid (CAS 81682-38-4) is a chemical compound with the molecular formula C8H6BrClO2 and a molecular weight of 249.49 g/mol. IUPAC name: 2-(2-bromo-5-chlorophenyl)acetic acid. InChIKey: ZPSZXWVBMOMXED-UHFFFAOYSA-N.
| Molecular formula | C8H6BrClO2 |
|---|---|
| Molecular weight | 249.49 g/mol |
| IUPAC name | 2-(2-bromo-5-chlorophenyl)acetic acid |
| InChIKey | ZPSZXWVBMOMXED-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)CC(=O)O)Br |
Computed by PubChem (NCBI)