cas: 162147-12-8 — see every product listed under this CAS number, including other names
2-Bromo-5-isopropoxybenzaldehyde, 97%, 97% (CAS 162147-12-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11AN67-250mg |
| cas | 162147-12-8 |
| size | 250mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 1g | 170.00 Pln | |
| Chemat | 5g | 448.40 Pln | |
| Chemat | 100mg | 93.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-bromo-5-propan-2-yloxybenzaldehyde (CAS 162147-12-8) is a chemical compound with the molecular formula C10H11BrO2 and a molecular weight of 243.10 g/mol. IUPAC name: 2-bromo-5-propan-2-yloxybenzaldehyde. InChIKey: RFXGGROPXWWLIF-UHFFFAOYSA-N.
| Molecular formula | C10H11BrO2 |
|---|---|
| Molecular weight | 243.10 g/mol |
| IUPAC name | 2-bromo-5-propan-2-yloxybenzaldehyde |
| InChIKey | RFXGGROPXWWLIF-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=CC(=C(C=C1)Br)C=O |
Computed by PubChem (NCBI)