CAS 2223035-36-5 appears in our catalog under these names: 2-Bromo-6-fluoropyridine-4-boronic acid, pinacol ester, 98%, 2-Bromo-6-fluoropyridine-4-boronic acid pinacol ester, 98%, 98%, 2-Bromo-6-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine, 98%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 5g, 1g, 100mg, 10g.
2-bromo-6-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 2223035-36-5) is a chemical compound with the molecular formula C11H14BBrFNO2 and a molecular weight of 301.95 g/mol. IUPAC name: 2-bromo-6-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: FDTPZVPRWWGWPZ-UHFFFAOYSA-N.
| Molecular formula | C11H14BBrFNO2 |
|---|---|
| Molecular weight | 301.95 g/mol |
| IUPAC name | 2-bromo-6-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | FDTPZVPRWWGWPZ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=NC(=C2)Br)F |
Computed by PubChem (NCBI)