CAS 2223038-87-5 appears in our catalog under these names: 3-Bromo-2-fluoropyridine-5-boronic acid, pinacol ester, 98%, 3-Bromo-2-fluoropyridine-5-boronic acid, pinacol ester. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 100mg.
3-bromo-2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 2223038-87-5) is a chemical compound with the molecular formula C11H14BBrFNO2 and a molecular weight of 301.95 g/mol. IUPAC name: 3-bromo-2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: XYJLDTKCQIPVJT-UHFFFAOYSA-N.
| Molecular formula | C11H14BBrFNO2 |
|---|---|
| Molecular weight | 301.95 g/mol |
| IUPAC name | 3-bromo-2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | XYJLDTKCQIPVJT-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(N=C2)F)Br |
Computed by PubChem (NCBI)