CAS 1264130-85-9 appears in our catalog under these names: 2-Bromo-3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine, 95+%, 6-Bromo-5-fluoropyridine-3-boronic acid pinacol ester. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 100mg, 50mg, 250mg, 500mg, 1000mg.
2-bromo-3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 1264130-85-9) is a chemical compound with the molecular formula C11H14BBrFNO2 and a molecular weight of 301.95 g/mol. IUPAC name: 2-bromo-3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: ZXAMHUBHLXMIOF-UHFFFAOYSA-N.
| Molecular formula | C11H14BBrFNO2 |
|---|---|
| Molecular weight | 301.95 g/mol |
| IUPAC name | 2-bromo-3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | ZXAMHUBHLXMIOF-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(N=C2)Br)F |
Computed by PubChem (NCBI)