CAS 1310404-04-6 is the registry number for 6-BroMo-2-fluoropyridine-3-boronic acid pinacol ester, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
6-bromo-2-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 1310404-04-6) is a chemical compound with the molecular formula C11H14BBrFNO2 and a molecular weight of 301.95 g/mol. IUPAC name: 6-bromo-2-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: YAJSHFMJZASPHX-UHFFFAOYSA-N.
| Molecular formula | C11H14BBrFNO2 |
|---|---|
| Molecular weight | 301.95 g/mol |
| IUPAC name | 6-bromo-2-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | YAJSHFMJZASPHX-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(N=C(C=C2)Br)F |
Computed by PubChem (NCBI)