CAS 1150561-78-6 appears in our catalog under these names: 3-Bromo-2-fluoropyridine-4-boronic acid pinacol ester, 95%, 3-Bromo-2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
3-bromo-2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 1150561-78-6) is a chemical compound with the molecular formula C11H14BBrFNO2 and a molecular weight of 301.95 g/mol. IUPAC name: 3-bromo-2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: IDLDFQKIZOVRPP-UHFFFAOYSA-N.
| Molecular formula | C11H14BBrFNO2 |
|---|---|
| Molecular weight | 301.95 g/mol |
| IUPAC name | 3-bromo-2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | IDLDFQKIZOVRPP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C(=NC=C2)F)Br |
Computed by PubChem (NCBI)