CAS 20357-21-5 appears in our catalog under these names: 2-Bromo-6-nitro benzaldehyde, 98%, 98%, 2-Bromo-6-nitrobenzaldehyde, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g, 500g.
2-bromo-6-nitrobenzaldehyde (CAS 20357-21-5) is a chemical compound with the molecular formula C7H4BrNO3 and a molecular weight of 230.02 g/mol. IUPAC name: 2-bromo-6-nitrobenzaldehyde. InChIKey: WRIAMYXQKSDDRP-UHFFFAOYSA-N.
| Molecular formula | C7H4BrNO3 |
|---|---|
| Molecular weight | 230.02 g/mol |
| IUPAC name | 2-bromo-6-nitrobenzaldehyde |
| InChIKey | WRIAMYXQKSDDRP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)C=O)[N+](=O)[O-] |
Computed by PubChem (NCBI)