Products 2470436-79-2

CAS 2470436-79-2 is the registry number for 2-(2-Bromopyridin-4-yl)-2-oxoacetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-(2-bromo-4-pyridinyl)-2-oxoacetic acid (CAS 2470436-79-2) is a chemical compound with the molecular formula C7H4BrNO3 and a molecular weight of 230.02 g/mol. IUPAC name: 2-(2-bromo-4-pyridinyl)-2-oxoacetic acid. InChIKey: YMNOMVCQCPVFEM-UHFFFAOYSA-N.

Identity
Molecular formulaC7H4BrNO3
Molecular weight230.02 g/mol
IUPAC name2-(2-bromo-4-pyridinyl)-2-oxoacetic acid
InChIKeyYMNOMVCQCPVFEM-UHFFFAOYSA-N
SMILESC1=CN=C(C=C1C(=O)C(=O)O)Br

Computed by PubChem (NCBI)