Products 2229533-15-5
CAS 2229533-15-5 is the registry number for 2-(6-Bromopyridin-3-yl)-2-oxoacetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(6-bromo-3-pyridinyl)-2-oxoacetic acid (CAS 2229533-15-5) is a chemical compound with the molecular formula C7H4BrNO3 and a molecular weight of 230.02 g/mol. IUPAC name: 2-(6-bromo-3-pyridinyl)-2-oxoacetic acid. InChIKey: UOCIQQTVUDPUFQ-UHFFFAOYSA-N.
| Molecular formula | C7H4BrNO3 |
|---|---|
| Molecular weight | 230.02 g/mol |
| IUPAC name | 2-(6-bromo-3-pyridinyl)-2-oxoacetic acid |
| InChIKey | UOCIQQTVUDPUFQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1C(=O)C(=O)O)Br |
Computed by PubChem (NCBI)
Synonyms:
2-(6-bromopyridin-3-yl)-2-oxoacetic acid