CAS 736186-60-0 is the registry number for Cyanomethyl 5-bromofuran-2-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Cyanomethyl 5-bromofuran-2-carboxylate (CAS 736186-60-0) is a chemical compound with the molecular formula C7H4BrNO3 and a molecular weight of 230.02 g/mol. IUPAC name: cyanomethyl 5-bromofuran-2-carboxylate. InChIKey: BRVMPWQITOCHHP-UHFFFAOYSA-N.
| Molecular formula | C7H4BrNO3 |
|---|---|
| Molecular weight | 230.02 g/mol |
| IUPAC name | cyanomethyl 5-bromofuran-2-carboxylate |
| InChIKey | BRVMPWQITOCHHP-UHFFFAOYSA-N |
| SMILES | C1=C(OC(=C1)Br)C(=O)OCC#N |
Computed by PubChem (NCBI)