CAS 332099-11-3 appears in our catalog under these names: 2-Bromo-4H-furo(3,2-b)pyrrole-5-carboxylic acid, 95+%, 2-Bromo-4H-furo(3,2-b)pyrrole-5-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
2-bromo-4H-furo[3,2-b]pyrrole-5-carboxylic acid (CAS 332099-11-3) is a chemical compound with the molecular formula C7H4BrNO3 and a molecular weight of 230.02 g/mol. IUPAC name: 2-bromo-4H-furo[3,2-b]pyrrole-5-carboxylic acid. InChIKey: WZMNTSZIYSQDAN-UHFFFAOYSA-N.
| Molecular formula | C7H4BrNO3 |
|---|---|
| Molecular weight | 230.02 g/mol |
| IUPAC name | 2-bromo-4H-furo[3,2-b]pyrrole-5-carboxylic acid |
| InChIKey | WZMNTSZIYSQDAN-UHFFFAOYSA-N |
| SMILES | C1=C(NC2=C1OC(=C2)Br)C(=O)O |
Computed by PubChem (NCBI)