2-Bromo-7-chlorodibenzo[b,d]furan, 98%, 98%
cas: 2355229-03-5 — see every product listed under this CAS number, including other names
2-Bromo-7-chlorodibenzo[b,d]furan, 98%, 98% (CAS 2355229-03-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 15g, 25g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch131KV4-100mg |
| cas | 2355229-03-5 |
| size | 100mg |
| availability | 100g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 102.80 Pln | |
| Chemat | 250mg | 122.00 Pln | |
| Chemat | 1g | 126.80 Pln | |
| Chemat | 5g | 309.20 Pln | |
| Chemat | 10g | 549.20 Pln | |
| Chemat | 15g | 774.80 Pln | |
| Chemat | 25g | 1134.80 Pln | |
| Chemat | 50g | 2099.60 Pln | |
| Chemat | 75g | 3083.60 Pln | |
| Chemat | 100g | 3952.40 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-bromo-7-chlorodibenzofuran (CAS 2355229-03-5) is a chemical compound with the molecular formula C12H6BrClO and a molecular weight of 281.53 g/mol. IUPAC name: 2-bromo-7-chlorodibenzofuran. InChIKey: QCGWGYFVRUSBRM-UHFFFAOYSA-N.
| Molecular formula | C12H6BrClO |
|---|---|
| Molecular weight | 281.53 g/mol |
| IUPAC name | 2-bromo-7-chlorodibenzofuran |
| InChIKey | QCGWGYFVRUSBRM-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)OC3=C2C=C(C=C3)Br |
Computed by PubChem (NCBI)