CAS 2144800-21-3 is the registry number for 6-Bromo-1-chlorodibenzo[b,d]furan, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-bromo-1-chlorodibenzofuran (CAS 2144800-21-3) is a chemical compound with the molecular formula C12H6BrClO and a molecular weight of 281.53 g/mol. IUPAC name: 6-bromo-1-chlorodibenzofuran. InChIKey: PLTPUZMBRVEWFL-UHFFFAOYSA-N.
| Molecular formula | C12H6BrClO |
|---|---|
| Molecular weight | 281.53 g/mol |
| IUPAC name | 6-bromo-1-chlorodibenzofuran |
| InChIKey | PLTPUZMBRVEWFL-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Br)OC3=C2C(=CC=C3)Cl |
Computed by PubChem (NCBI)