CAS 2225909-61-3 is the registry number for 8–Bromo–1–chlorodibenzo(b,d)furan. Offered by: GLPBio. Available pack sizes: 1g.
8-bromo-1-chlorodibenzofuran (CAS 2225909-61-3) is a chemical compound with the molecular formula C12H6BrClO and a molecular weight of 281.53 g/mol. IUPAC name: 8-bromo-1-chlorodibenzofuran. InChIKey: RQYIRZGKJJIGSU-UHFFFAOYSA-N.
| Molecular formula | C12H6BrClO |
|---|---|
| Molecular weight | 281.53 g/mol |
| IUPAC name | 8-bromo-1-chlorodibenzofuran |
| InChIKey | RQYIRZGKJJIGSU-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Cl)C3=C(O2)C=CC(=C3)Br |
Computed by PubChem (NCBI)