CAS 2179279-99-1 is the registry number for 6-Bromo-2-chlorodibenzo[b,d]furan, 98%. Offered by: Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
6-bromo-2-chlorodibenzofuran (CAS 2179279-99-1) is a chemical compound with the molecular formula C12H6BrClO and a molecular weight of 281.53 g/mol. IUPAC name: 6-bromo-2-chlorodibenzofuran. InChIKey: ANJKWKBXTYYTCY-UHFFFAOYSA-N.
| Molecular formula | C12H6BrClO |
|---|---|
| Molecular weight | 281.53 g/mol |
| IUPAC name | 6-bromo-2-chlorodibenzofuran |
| InChIKey | ANJKWKBXTYYTCY-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Br)OC3=C2C=C(C=C3)Cl |
Computed by PubChem (NCBI)