Products 889109-65-3

CAS 889109-65-3 is the registry number for 4-Bromo-6-chlorodibenzo[b,d]furan, 98%, 98%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g, 25g.

Structural formula: {0} (CAS {1})

4-bromo-6-chlorodibenzofuran (CAS 889109-65-3) is a chemical compound with the molecular formula C12H6BrClO and a molecular weight of 281.53 g/mol. IUPAC name: 4-bromo-6-chlorodibenzofuran. InChIKey: VAKXVDUJGANVGE-UHFFFAOYSA-N.

Identity
Molecular formulaC12H6BrClO
Molecular weight281.53 g/mol
IUPAC name4-bromo-6-chlorodibenzofuran
InChIKeyVAKXVDUJGANVGE-UHFFFAOYSA-N
SMILESC1=CC2=C(C(=C1)Cl)OC3=C2C=CC=C3Br

Computed by PubChem (NCBI)