cas: 138733-50-3 — see every product listed under this CAS number, including other names
2-Bromo-N-(tert-butyl)benzenesulfonamide 96% (CAS 138733-50-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A196016-250mg |
| cas | 138733-50-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 264.69 Pln | |
| Ambeed | 1g | 570.62 Pln | |
| Ambeed | 5g | 1577.44 Pln | |
| Ambeed | 10g | 2712.19 Pln |
| purity | 96% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A196016 |
2-bromo-N-tert-butylbenzenesulfonamide (CAS 138733-50-3) is a chemical compound with the molecular formula C10H14BrNO2S and a molecular weight of 292.19 g/mol. IUPAC name: 2-bromo-N-tert-butylbenzenesulfonamide. InChIKey: AMQGWGSNHQLIJT-UHFFFAOYSA-N.
| Molecular formula | C10H14BrNO2S |
|---|---|
| Molecular weight | 292.19 g/mol |
| IUPAC name | 2-bromo-N-tert-butylbenzenesulfonamide |
| InChIKey | AMQGWGSNHQLIJT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NS(=O)(=O)C1=CC=CC=C1Br |
Computed by PubChem (NCBI)