cas: 138733-50-3 — see every product listed under this CAS number, including other names
2-Bromo-N-(tert-butyl)benzenesulfonamide, 96%, 96% (CAS 138733-50-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1120GE-250mg |
| cas | 138733-50-3 |
| size | 250mg |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 213.20 Pln | |
| Chemat | 1g | 448.40 Pln | |
| Chemat | 5g | 1221.20 Pln | |
| Chemat | 10g | 2090.00 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
2-bromo-N-tert-butylbenzenesulfonamide (CAS 138733-50-3) is a chemical compound with the molecular formula C10H14BrNO2S and a molecular weight of 292.19 g/mol. IUPAC name: 2-bromo-N-tert-butylbenzenesulfonamide. InChIKey: AMQGWGSNHQLIJT-UHFFFAOYSA-N.
| Molecular formula | C10H14BrNO2S |
|---|---|
| Molecular weight | 292.19 g/mol |
| IUPAC name | 2-bromo-N-tert-butylbenzenesulfonamide |
| InChIKey | AMQGWGSNHQLIJT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NS(=O)(=O)C1=CC=CC=C1Br |
Computed by PubChem (NCBI)