cas: 350672-14-9 — see every product listed under this CAS number, including other names
2-CHLOROMETHYL-5-(4-FLUOROPHENYL)-[1,3,4]OXADIAZOLE, 97% (CAS 350672-14-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F302783-1G |
| cas | 350672-14-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1257.91 Pln | |
| Fluorochem | 5g | 4199.58 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-(chloromethyl)-5-(4-fluorophenyl)-1,3,4-oxadiazole (CAS 350672-14-9) is a chemical compound with the molecular formula C9H6ClFN2O and a molecular weight of 212.61 g/mol. IUPAC name: 2-(chloromethyl)-5-(4-fluorophenyl)-1,3,4-oxadiazole. InChIKey: QHQRMDRNRFBTPI-UHFFFAOYSA-N.
| Molecular formula | C9H6ClFN2O |
|---|---|
| Molecular weight | 212.61 g/mol |
| IUPAC name | 2-(chloromethyl)-5-(4-fluorophenyl)-1,3,4-oxadiazole |
| InChIKey | QHQRMDRNRFBTPI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NN=C(O2)CCl)F |
Computed by PubChem (NCBI)