CAS 350672-14-9 appears in our catalog under these names: 2-(Chloromethyl)-5-(4-fluorophenyl)-1,3,4-oxadiazole, 95%, 2-(Chloromethyl)-5-(4-fluorophenyl)-1,3,4-oxadiazole, 2-CHLOROMETHYL-5-(4-FLUOROPHENYL)-[1,3,4]OXADIAZOLE, 97%. Offered by: Combi-blocks, Biosynth, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 0,5g.
2-(chloromethyl)-5-(4-fluorophenyl)-1,3,4-oxadiazole (CAS 350672-14-9) is a chemical compound with the molecular formula C9H6ClFN2O and a molecular weight of 212.61 g/mol. IUPAC name: 2-(chloromethyl)-5-(4-fluorophenyl)-1,3,4-oxadiazole. InChIKey: QHQRMDRNRFBTPI-UHFFFAOYSA-N.
| Molecular formula | C9H6ClFN2O |
|---|---|
| Molecular weight | 212.61 g/mol |
| IUPAC name | 2-(chloromethyl)-5-(4-fluorophenyl)-1,3,4-oxadiazole |
| InChIKey | QHQRMDRNRFBTPI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NN=C(O2)CCl)F |
Computed by PubChem (NCBI)