Products 601484-33-7
CAS 601484-33-7 appears in our catalog under these names: 5-(Chloromethyl)-3-(3-fluorophenyl)-1,2,4-oxadiazole, 98%, 5-(Chloromethyl)-3-(3-fluorophenyl)-1,2,4-oxadiazole, 97%, 5–(Chloromethyl)–3–(3–Fluorophenyl)–1，2，4–Oxadiazole, 5-(Chloromethyl)-3-(3-fluorophenyl)-1,2,4-oxadiazole, 97%, 97%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 10g, 5g, 100mg, 250mg, 25g.
5-(chloromethyl)-3-(3-fluorophenyl)-1,2,4-oxadiazole (CAS 601484-33-7) is a chemical compound with the molecular formula C9H6ClFN2O and a molecular weight of 212.61 g/mol. IUPAC name: 5-(chloromethyl)-3-(3-fluorophenyl)-1,2,4-oxadiazole. InChIKey: OFVIHHHWOQCWEK-UHFFFAOYSA-N.
| Molecular formula | C9H6ClFN2O |
|---|---|
| Molecular weight | 212.61 g/mol |
| IUPAC name | 5-(chloromethyl)-3-(3-fluorophenyl)-1,2,4-oxadiazole |
| InChIKey | OFVIHHHWOQCWEK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)C2=NOC(=N2)CCl |
Computed by PubChem (NCBI)