CAS 721428-34-8 appears in our catalog under these names: 5-Chloromethyl-3-(4-fluoro-phenyl)-[1,2,4]oxadiazole, 98%, 5–(Chloromethyl)–3–(4–fluorophenyl)–1,2,4–oxadiazole, 5-(Chloromethyl)-3-(4-fluorophenyl)-1,2,4-oxadiazole 98%, 5-Chloromethyl-3-(4-fluoro-phenyl)-[1,2,4]oxadiazole, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Fluorochem. Available pack sizes: 1g, 10g, 5g, 25g, 250mg, 100g.
5-(chloromethyl)-3-(4-fluorophenyl)-1,2,4-oxadiazole (CAS 721428-34-8) is a chemical compound with the molecular formula C9H6ClFN2O and a molecular weight of 212.61 g/mol. IUPAC name: 5-(chloromethyl)-3-(4-fluorophenyl)-1,2,4-oxadiazole. InChIKey: LMZZSCWNPOUYES-UHFFFAOYSA-N.
| Molecular formula | C9H6ClFN2O |
|---|---|
| Molecular weight | 212.61 g/mol |
| IUPAC name | 5-(chloromethyl)-3-(4-fluorophenyl)-1,2,4-oxadiazole |
| InChIKey | LMZZSCWNPOUYES-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NOC(=N2)CCl)F |
Computed by PubChem (NCBI)