CAS 110704-45-5 appears in our catalog under these names: 5-(Chloromethyl)-3-(2-fluorophenyl)-1,2,4-oxadiazole, 5-(Chloromethyl)-3-(2-fluorophenyl)-1,2,4-oxadiazole, 98%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 10g, 1g, 5g.
5-(chloromethyl)-3-(2-fluorophenyl)-1,2,4-oxadiazole (CAS 110704-45-5) is a chemical compound with the molecular formula C9H6ClFN2O and a molecular weight of 212.61 g/mol. IUPAC name: 5-(chloromethyl)-3-(2-fluorophenyl)-1,2,4-oxadiazole. InChIKey: OUTFQFIWFLMIOE-UHFFFAOYSA-N.
| Molecular formula | C9H6ClFN2O |
|---|---|
| Molecular weight | 212.61 g/mol |
| IUPAC name | 5-(chloromethyl)-3-(2-fluorophenyl)-1,2,4-oxadiazole |
| InChIKey | OUTFQFIWFLMIOE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NOC(=N2)CCl)F |
Computed by PubChem (NCBI)