cas: 847148-17-8 — see every product listed under this CAS number, including other names
2-Chloro-1-fluoro-4-(methylsulfonyl)benzene (CAS 847148-17-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F210690-5G |
| cas | 847148-17-8 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 2601.19 Pln | |
| Fluorochem | 1g | 914.28 Pln |
| delivery time | 3-4 weeks |
|---|
2-chloro-1-fluoro-4-methylsulfonylbenzene (CAS 847148-17-8) is a chemical compound with the molecular formula C7H6ClFO2S and a molecular weight of 208.64 g/mol. IUPAC name: 2-chloro-1-fluoro-4-methylsulfonylbenzene. InChIKey: QJUXXQFUEROZHT-UHFFFAOYSA-N.
| Molecular formula | C7H6ClFO2S |
|---|---|
| Molecular weight | 208.64 g/mol |
| IUPAC name | 2-chloro-1-fluoro-4-methylsulfonylbenzene |
| InChIKey | QJUXXQFUEROZHT-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC(=C(C=C1)F)Cl |
Computed by PubChem (NCBI)