cas: 1382851-54-8 — see every product listed under this CAS number, including other names
2-Chloro-4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine 98% (CAS 1382851-54-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A277697-250mg |
| cas | 1382851-54-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 381.50 Pln | |
| Ambeed | 1g | 882.12 Pln | |
| Ambeed | 5g | 2990.31 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A277697 |
2-chloro-4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 1382851-54-8) is a chemical compound with the molecular formula C12H17BClNO2 and a molecular weight of 253.53 g/mol. IUPAC name: 2-chloro-4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: KZUQWAUTULOJHN-UHFFFAOYSA-N.
| Molecular formula | C12H17BClNO2 |
|---|---|
| Molecular weight | 253.53 g/mol |
| IUPAC name | 2-chloro-4-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | KZUQWAUTULOJHN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(C=C2C)Cl |
Computed by PubChem (NCBI)