CAS 1073371-77-3 appears in our catalog under these names: 4–Chloro–2–(4,4,5,5–tetramethyl–1,3,2–dioxaborolan–2–yl)aniline, 2-Amino-5-chlorophenylboronic acid pinacol ester, 97%, 4-Chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline 96%, 2-Amino-5-chlorophenylboronic Acid Pinacol Ester, 96%, 96%, 4-Chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline, 97%. Offered by: GLPBio, Thermo Scientific (Acros), Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg, 10g, 25g, 100g, 500g.
4-chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline (CAS 1073371-77-3) is a chemical compound with the molecular formula C12H17BClNO2 and a molecular weight of 253.53 g/mol. IUPAC name: 4-chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline. InChIKey: GVJZHGCVSYBPIM-UHFFFAOYSA-N.
| Molecular formula | C12H17BClNO2 |
|---|---|
| Molecular weight | 253.53 g/mol |
| IUPAC name | 4-chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
| InChIKey | GVJZHGCVSYBPIM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)Cl)N |
Computed by PubChem (NCBI)