CAS 1010101-07-1 appears in our catalog under these names: 2-Chloro-3-methylpyridine-5-boronic acid pinacol ester, 98%, 2–Chloro–3–methylpyridine–5–boronic Acid Pinacol Ester, 2-Chloro-3-methylpyridine-5-boronic Acid Pinacol Ester 98%, 2-Chloro-3-methylpyridine-5-boronic acid pinacol ester, 98%, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 250mg, 100mg, 25g.
2-chloro-3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 1010101-07-1) is a chemical compound with the molecular formula C12H17BClNO2 and a molecular weight of 253.53 g/mol. IUPAC name: 2-chloro-3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: FQLRMOOIOJBHPS-UHFFFAOYSA-N.
| Molecular formula | C12H17BClNO2 |
|---|---|
| Molecular weight | 253.53 g/mol |
| IUPAC name | 2-chloro-3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | FQLRMOOIOJBHPS-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(N=C2)Cl)C |
Computed by PubChem (NCBI)