CAS 877160-63-9 appears in our catalog under these names: 4-Amino-2-chlorophenylboronic acid, pinacol ester, 98%, 4–Amino–2–chlorophenylboronic acid pinacol ester, 4-Amino-2-chlorophenylboronic acid pinacol ester, 4-Amino-2-chlorophenylboronic acid pinacol ester, 97%, 4-Amino-2-chlorophenylboronic acid,pinacolester 96%. Offered by: Combi-blocks, GLPBio, Biosynth, Thermo Scientific (Acros), Ambeed. Available pack sizes: 5g, 1g, 250mg, 500mg, 1000mg, 100mg, 10g, 25g.
3-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline (CAS 877160-63-9) is a chemical compound with the molecular formula C12H17BClNO2 and a molecular weight of 253.53 g/mol. IUPAC name: 3-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline. InChIKey: YKQXROMICPMQBZ-UHFFFAOYSA-N.
| Molecular formula | C12H17BClNO2 |
|---|---|
| Molecular weight | 253.53 g/mol |
| IUPAC name | 3-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
| InChIKey | YKQXROMICPMQBZ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)N)Cl |
Computed by PubChem (NCBI)