Products 2096998-30-8
CAS 2096998-30-8 is the registry number for 6-Chloro-3-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
6-chloro-3-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 2096998-30-8) is a chemical compound with the molecular formula C12H17BClNO2 and a molecular weight of 253.53 g/mol. IUPAC name: 6-chloro-3-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: KGCCRLWSFGILDW-UHFFFAOYSA-N.
| Molecular formula | C12H17BClNO2 |
|---|---|
| Molecular weight | 253.53 g/mol |
| IUPAC name | 6-chloro-3-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | KGCCRLWSFGILDW-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=N2)Cl)C |
Computed by PubChem (NCBI)