cas: 30937-70-3 — see every product listed under this CAS number, including other names
2-Chloro-4-methyl-6-phenyl-1,3,5-triazine, >97%, >97% (CAS 30937-70-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12UC65-100mg |
| cas | 30937-70-3 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 438.80 Pln | |
| Chemat | 250mg | 702.80 Pln | |
| Chemat | 1g | 990.80 Pln | |
| Chemat | 5g | 2267.60 Pln | |
| Chemat | 10g | 3438.80 Pln |
| purity | >97% |
|---|---|
| delivery time | 3 weeks |
2-chloro-4-methyl-6-phenyl-1,3,5-triazine (CAS 30937-70-3) is a chemical compound with the molecular formula C10H8ClN3 and a molecular weight of 205.64 g/mol. IUPAC name: 2-chloro-4-methyl-6-phenyl-1,3,5-triazine. InChIKey: MZHFNHGPRUIATC-UHFFFAOYSA-N.
| Molecular formula | C10H8ClN3 |
|---|---|
| Molecular weight | 205.64 g/mol |
| IUPAC name | 2-chloro-4-methyl-6-phenyl-1,3,5-triazine |
| InChIKey | MZHFNHGPRUIATC-UHFFFAOYSA-N |
| SMILES | CC1=NC(=NC(=N1)Cl)C2=CC=CC=C2 |
Computed by PubChem (NCBI)