CAS 370571-25-8 is the registry number for 6-Chloro-n-(pyridin-3-yl)pyridin-2-amine, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
6-chloro-N-pyridin-3-ylpyridin-2-amine (CAS 370571-25-8) is a chemical compound with the molecular formula C10H8ClN3 and a molecular weight of 205.64 g/mol. IUPAC name: 6-chloro-N-pyridin-3-ylpyridin-2-amine. InChIKey: NUFDTAFXFJULSE-UHFFFAOYSA-N.
| Molecular formula | C10H8ClN3 |
|---|---|
| Molecular weight | 205.64 g/mol |
| IUPAC name | 6-chloro-N-pyridin-3-ylpyridin-2-amine |
| InChIKey | NUFDTAFXFJULSE-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1)Cl)NC2=CN=CC=C2 |
Computed by PubChem (NCBI)